About 6-bromo-1-chloro-1,2,3,4-tetrahydronaphthalene
6-bromo-1-chloro-1,2,3,4-tetrahydronaphthalene (PubChem CID 18469942) has the molecular formula C10H10BrCl
and a molecular weight of 245.55 g/mol. Its IUPAC name is 6-bromo-1-chloro-1,2,3,4-tetrahydronaphthalene.
Molecular Properties
| Compound Name | 6-bromo-1-chloro-1,2,3,4-tetrahydronaphthalene |
| PubChem CID | 18469942 |
| Molecular Formula | C10H10BrCl |
| Molecular Weight | 245.55 g/mol |
| Exact Mass | 243.97 |
| IUPAC Name | 6-bromo-1-chloro-1,2,3,4-tetrahydronaphthalene |
| SMILES | ClC1CCCc2cc(Br)ccc21 |
| InChI | InChI=1S/C10H10BrCl/c11-8-4-5-9-7(6-8)2-1-3-10(9)12/h4-6,10H,1-3H2 |
| InChIKey | AGGLFVMRWUWTTL-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.55 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-1-chloro-1,2,3,4-tetrahydronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1-chloro-1,2,3,4-tetrahydronaphthalene?
The IUPAC name of 6-bromo-1-chloro-1,2,3,4-tetrahydronaphthalene (CID 18469942) is 6-bromo-1-chloro-1,2,3,4-tetrahydronaphthalene.
What is the SMILES notation for 6-bromo-1-chloro-1,2,3,4-tetrahydronaphthalene?
The canonical SMILES for 6-bromo-1-chloro-1,2,3,4-tetrahydronaphthalene is ClC1CCCc2cc(Br)ccc21.
What is the InChIKey of 6-bromo-1-chloro-1,2,3,4-tetrahydronaphthalene?
The InChIKey is AGGLFVMRWUWTTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BrCl/c11-8-4-5-9-7(6-8)2-1-3-10(9)12/h4-6,10H,1-3H2.
What are the key properties of 6-bromo-1-chloro-1,2,3,4-tetrahydronaphthalene?
6-bromo-1-chloro-1,2,3,4-tetrahydronaphthalene has a molecular weight of 245.55 g/mol, XLogP of 4.07, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1-chloro-1,2,3,4-tetrahydronaphthalene is sourced from PubChem (CID 18469942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).