About 2-[(2-bromo-1-oxo-2,3-dihydroinden-5-yl)oxy]acetate
2-[(2-bromo-1-oxo-2,3-dihydroinden-5-yl)oxy]acetate (PubChem CID 18471042) has the molecular formula C11H8BrO4-
and a molecular weight of 284.09 g/mol. Its IUPAC name is 2-[(2-bromo-1-oxo-2,3-dihydroinden-5-yl)oxy]acetate.
Molecular Properties
| Compound Name | 2-[(2-bromo-1-oxo-2,3-dihydroinden-5-yl)oxy]acetate |
| PubChem CID | 18471042 |
| Molecular Formula | C11H8BrO4- |
| Molecular Weight | 284.09 g/mol |
| Exact Mass | 282.96 |
| IUPAC Name | 2-[(2-bromo-1-oxo-2,3-dihydroinden-5-yl)oxy]acetate |
| SMILES | O=C([O-])COc1ccc2c(c1)CC(Br)C2=O |
| InChI | InChI=1S/C11H9BrO4/c12-9-4-6-3-7(16-5-10(13)14)1-2-8(6)11(9)15/h1-3,9H,4-5H2,(H,13,14)/p-1 |
| InChIKey | MGKAMPAYQFFHAV-UHFFFAOYSA-M |
| XLogP | 0.32 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.09 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2-bromo-1-oxo-2,3-dihydroinden-5-yl)oxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-bromo-1-oxo-2,3-dihydroinden-5-yl)oxy]acetate?
The IUPAC name of 2-[(2-bromo-1-oxo-2,3-dihydroinden-5-yl)oxy]acetate (CID 18471042) is 2-[(2-bromo-1-oxo-2,3-dihydroinden-5-yl)oxy]acetate.
What is the SMILES notation for 2-[(2-bromo-1-oxo-2,3-dihydroinden-5-yl)oxy]acetate?
The canonical SMILES for 2-[(2-bromo-1-oxo-2,3-dihydroinden-5-yl)oxy]acetate is O=C([O-])COc1ccc2c(c1)CC(Br)C2=O.
What is the InChIKey of 2-[(2-bromo-1-oxo-2,3-dihydroinden-5-yl)oxy]acetate?
The InChIKey is MGKAMPAYQFFHAV-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H9BrO4/c12-9-4-6-3-7(16-5-10(13)14)1-2-8(6)11(9)15/h1-3,9H,4-5H2,(H,13,14)/p-1.
What are the key properties of 2-[(2-bromo-1-oxo-2,3-dihydroinden-5-yl)oxy]acetate?
2-[(2-bromo-1-oxo-2,3-dihydroinden-5-yl)oxy]acetate has a molecular weight of 284.09 g/mol, XLogP of 0.32, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-bromo-1-oxo-2,3-dihydroinden-5-yl)oxy]acetate is sourced from PubChem (CID 18471042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).