About 3,3-dimethyloxetane;2,2,3-trifluorooxirane
3,3-dimethyloxetane;2,2,3-trifluorooxirane (PubChem CID 18471375) has the molecular formula C7H11F3O2
and a molecular weight of 184.16 g/mol. Its IUPAC name is 3,3-dimethyloxetane;2,2,3-trifluorooxirane.
Molecular Properties
| Compound Name | 3,3-dimethyloxetane;2,2,3-trifluorooxirane |
| PubChem CID | 18471375 |
| Molecular Formula | C7H11F3O2 |
| Molecular Weight | 184.16 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 3,3-dimethyloxetane;2,2,3-trifluorooxirane |
| SMILES | CC1(C)COC1.FC1OC1(F)F |
| InChI | InChI=1S/C5H10O.C2HF3O/c1-5(2)3-6-4-5;3-1-2(4,5)6-1/h3-4H2,1-2H3;1H |
| InChIKey | WTGUTSZLFODLGN-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.16 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dimethyloxetane;2,2,3-trifluorooxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyloxetane;2,2,3-trifluorooxirane?
The IUPAC name of 3,3-dimethyloxetane;2,2,3-trifluorooxirane (CID 18471375) is 3,3-dimethyloxetane;2,2,3-trifluorooxirane.
What is the SMILES notation for 3,3-dimethyloxetane;2,2,3-trifluorooxirane?
The canonical SMILES for 3,3-dimethyloxetane;2,2,3-trifluorooxirane is CC1(C)COC1.FC1OC1(F)F.
What is the InChIKey of 3,3-dimethyloxetane;2,2,3-trifluorooxirane?
The InChIKey is WTGUTSZLFODLGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O.C2HF3O/c1-5(2)3-6-4-5;3-1-2(4,5)6-1/h3-4H2,1-2H3;1H.
What are the key properties of 3,3-dimethyloxetane;2,2,3-trifluorooxirane?
3,3-dimethyloxetane;2,2,3-trifluorooxirane has a molecular weight of 184.16 g/mol, XLogP of 1.95, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyloxetane;2,2,3-trifluorooxirane is sourced from PubChem (CID 18471375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).