C4F7N3O3S — CID 18471548
N-diazo-1,1,2,2-tetrafluoro-2-(1,2,2-trifluoroethenoxy)ethanesulfonamide (PubChem CID 18471548) has the molecular formula C4F7N3O3S and a molecular weight of 303.12 g/mol. Its IUPAC name is N-diazo-1,1,2,2-tetrafluoro-2-(1,2,2-trifluoroethenoxy)ethanesulfonamide.
| Compound Name | N-diazo-1,1,2,2-tetrafluoro-2-(1,2,2-trifluoroethenoxy)ethanesulfonamide |
|---|---|
| PubChem CID | 18471548 |
| Molecular Formula | C4F7N3O3S |
| Molecular Weight | 303.12 g/mol |
| Exact Mass | 302.95 |
| IUPAC Name | N-diazo-1,1,2,2-tetrafluoro-2-(1,2,2-trifluoroethenoxy)ethanesulfonamide |
| SMILES | [N-]=[N+]=NS(=O)(=O)C(F)(F)C(F)(F)OC(F)=C(F)F |
| InChI | InChI=1S/C4F7N3O3S/c5-1(6)2(7)17-3(8,9)4(10,11)18(15,16)14-13-12 |
| InChIKey | QWZIWCIAQAGHOI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 92.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.12 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|