About (1Z)-4-cyano-N-[2,6-dichloro-4-(trifluoromethyl)anilino]benzenecarboximidoyl cyanide
(1Z)-4-cyano-N-[2,6-dichloro-4-(trifluoromethyl)anilino]benzenecarboximidoyl cyanide (PubChem CID 18471601) has the molecular formula C16H7Cl2F3N4
and a molecular weight of 383.16 g/mol. Its IUPAC name is (1Z)-4-cyano-N-[2,6-dichloro-4-(trifluoromethyl)anilino]benzenecarboximidoyl cyanide.
Molecular Properties
| Compound Name | (1Z)-4-cyano-N-[2,6-dichloro-4-(trifluoromethyl)anilino]benzenecarboximidoyl cyanide |
| PubChem CID | 18471601 |
| Molecular Formula | C16H7Cl2F3N4 |
| Molecular Weight | 383.16 g/mol |
| Exact Mass | 382.00 |
| IUPAC Name | (1Z)-4-cyano-N-[2,6-dichloro-4-(trifluoromethyl)anilino]benzenecarboximidoyl cyanide |
| SMILES | N#C/C(=N\Nc1c(Cl)cc(C(F)(F)F)cc1Cl)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C16H7Cl2F3N4/c17-12-5-11(16(19,20)21)6-13(18)15(12)25-24-14(8-23)10-3-1-9(7-22)2-4-10/h1-6,25H/b24-14+ |
| InChIKey | YSZDBBWVLFFSKP-ZVHZXABRSA-N |
| XLogP | 5.22 |
| TPSA | 71.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.16 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1Z)-4-cyano-N-[2,6-dichloro-4-(trifluoromethyl)anilino]benzenecarboximidoyl cyanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-4-cyano-N-[2,6-dichloro-4-(trifluoromethyl)anilino]benzenecarboximidoyl cyanide?
The IUPAC name of (1Z)-4-cyano-N-[2,6-dichloro-4-(trifluoromethyl)anilino]benzenecarboximidoyl cyanide (CID 18471601) is (1Z)-4-cyano-N-[2,6-dichloro-4-(trifluoromethyl)anilino]benzenecarboximidoyl cyanide.
What is the SMILES notation for (1Z)-4-cyano-N-[2,6-dichloro-4-(trifluoromethyl)anilino]benzenecarboximidoyl cyanide?
The canonical SMILES for (1Z)-4-cyano-N-[2,6-dichloro-4-(trifluoromethyl)anilino]benzenecarboximidoyl cyanide is N#C/C(=N\Nc1c(Cl)cc(C(F)(F)F)cc1Cl)c1ccc(C#N)cc1.
What is the InChIKey of (1Z)-4-cyano-N-[2,6-dichloro-4-(trifluoromethyl)anilino]benzenecarboximidoyl cyanide?
The InChIKey is YSZDBBWVLFFSKP-ZVHZXABRSA-N. The full InChI is InChI=1S/C16H7Cl2F3N4/c17-12-5-11(16(19,20)21)6-13(18)15(12)25-24-14(8-23)10-3-1-9(7-22)2-4-10/h1-6,25H/b24-14+.
What are the key properties of (1Z)-4-cyano-N-[2,6-dichloro-4-(trifluoromethyl)anilino]benzenecarboximidoyl cyanide?
(1Z)-4-cyano-N-[2,6-dichloro-4-(trifluoromethyl)anilino]benzenecarboximidoyl cyanide has a molecular weight of 383.16 g/mol, XLogP of 5.22, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-4-cyano-N-[2,6-dichloro-4-(trifluoromethyl)anilino]benzenecarboximidoyl cyanide is sourced from PubChem (CID 18471601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).