About (1Z)-4-cyano-N-[2,6-dichloro-4-(trifluoromethyl)phenyl]benzenecarbohydrazonoyl chloride
(1Z)-4-cyano-N-[2,6-dichloro-4-(trifluoromethyl)phenyl]benzenecarbohydrazonoyl chloride (PubChem CID 18471607) has the molecular formula C15H7Cl3F3N3
and a molecular weight of 392.60 g/mol. Its IUPAC name is (1Z)-4-cyano-N-[2,6-dichloro-4-(trifluoromethyl)phenyl]benzenecarbohydrazonoyl chloride.
Molecular Properties
| Compound Name | (1Z)-4-cyano-N-[2,6-dichloro-4-(trifluoromethyl)phenyl]benzenecarbohydrazonoyl chloride |
| PubChem CID | 18471607 |
| Molecular Formula | C15H7Cl3F3N3 |
| Molecular Weight | 392.60 g/mol |
| Exact Mass | 390.97 |
| IUPAC Name | (1Z)-4-cyano-N-[2,6-dichloro-4-(trifluoromethyl)phenyl]benzenecarbohydrazonoyl chloride |
| SMILES | N#Cc1ccc(/C(Cl)=N/Nc2c(Cl)cc(C(F)(F)F)cc2Cl)cc1 |
| InChI | InChI=1S/C15H7Cl3F3N3/c16-11-5-10(15(19,20)21)6-12(17)13(11)23-24-14(18)9-3-1-8(7-22)2-4-9/h1-6,23H/b24-14- |
| InChIKey | HBDLEAMVAIHZHK-OYKKKHCWSA-N |
| XLogP | 5.90 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.60 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1Z)-4-cyano-N-[2,6-dichloro-4-(trifluoromethyl)phenyl]benzenecarbohydrazonoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-4-cyano-N-[2,6-dichloro-4-(trifluoromethyl)phenyl]benzenecarbohydrazonoyl chloride?
The IUPAC name of (1Z)-4-cyano-N-[2,6-dichloro-4-(trifluoromethyl)phenyl]benzenecarbohydrazonoyl chloride (CID 18471607) is (1Z)-4-cyano-N-[2,6-dichloro-4-(trifluoromethyl)phenyl]benzenecarbohydrazonoyl chloride.
What is the SMILES notation for (1Z)-4-cyano-N-[2,6-dichloro-4-(trifluoromethyl)phenyl]benzenecarbohydrazonoyl chloride?
The canonical SMILES for (1Z)-4-cyano-N-[2,6-dichloro-4-(trifluoromethyl)phenyl]benzenecarbohydrazonoyl chloride is N#Cc1ccc(/C(Cl)=N/Nc2c(Cl)cc(C(F)(F)F)cc2Cl)cc1.
What is the InChIKey of (1Z)-4-cyano-N-[2,6-dichloro-4-(trifluoromethyl)phenyl]benzenecarbohydrazonoyl chloride?
The InChIKey is HBDLEAMVAIHZHK-OYKKKHCWSA-N. The full InChI is InChI=1S/C15H7Cl3F3N3/c16-11-5-10(15(19,20)21)6-12(17)13(11)23-24-14(18)9-3-1-8(7-22)2-4-9/h1-6,23H/b24-14-.
What are the key properties of (1Z)-4-cyano-N-[2,6-dichloro-4-(trifluoromethyl)phenyl]benzenecarbohydrazonoyl chloride?
(1Z)-4-cyano-N-[2,6-dichloro-4-(trifluoromethyl)phenyl]benzenecarbohydrazonoyl chloride has a molecular weight of 392.60 g/mol, XLogP of 5.90, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-4-cyano-N-[2,6-dichloro-4-(trifluoromethyl)phenyl]benzenecarbohydrazonoyl chloride is sourced from PubChem (CID 18471607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).