About 2,2-dimethylcarbazole
2,2-dimethylcarbazole (PubChem CID 18471893) has the molecular formula C14H13N
and a molecular weight of 195.27 g/mol. Its IUPAC name is 2,2-dimethylcarbazole.
Molecular Properties
| Compound Name | 2,2-dimethylcarbazole |
| PubChem CID | 18471893 |
| Molecular Formula | C14H13N |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 2,2-dimethylcarbazole |
| SMILES | CC1(C)C=CC2=c3ccccc3=NC2=C1 |
| InChI | InChI=1S/C14H13N/c1-14(2)8-7-11-10-5-3-4-6-12(10)15-13(11)9-14/h3-9H,1-2H3 |
| InChIKey | JOACCKKFMSCHQI-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,2-dimethylcarbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylcarbazole?
The IUPAC name of 2,2-dimethylcarbazole (CID 18471893) is 2,2-dimethylcarbazole.
What is the SMILES notation for 2,2-dimethylcarbazole?
The canonical SMILES for 2,2-dimethylcarbazole is CC1(C)C=CC2=c3ccccc3=NC2=C1.
What is the InChIKey of 2,2-dimethylcarbazole?
The InChIKey is JOACCKKFMSCHQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N/c1-14(2)8-7-11-10-5-3-4-6-12(10)15-13(11)9-14/h3-9H,1-2H3.
What are the key properties of 2,2-dimethylcarbazole?
2,2-dimethylcarbazole has a molecular weight of 195.27 g/mol, XLogP of 1.95, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylcarbazole is sourced from PubChem (CID 18471893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).