About methyl 2-amino-4,5-difluorobenzoate
methyl 2-amino-4,5-difluorobenzoate (PubChem CID 18472001) has the molecular formula C8H7F2NO2
and a molecular weight of 187.14 g/mol. Its IUPAC name is methyl 2-amino-4,5-difluorobenzoate.
Molecular Properties
| Compound Name | methyl 2-amino-4,5-difluorobenzoate |
| PubChem CID | 18472001 |
| Molecular Formula | C8H7F2NO2 |
| Molecular Weight | 187.14 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | methyl 2-amino-4,5-difluorobenzoate |
| SMILES | COC(=O)c1cc(F)c(F)cc1N |
| InChI | InChI=1S/C8H7F2NO2/c1-13-8(12)4-2-5(9)6(10)3-7(4)11/h2-3H,11H2,1H3 |
| InChIKey | VIAQNTRKUPBQKR-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.14 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-amino-4,5-difluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-amino-4,5-difluorobenzoate?
The IUPAC name of methyl 2-amino-4,5-difluorobenzoate (CID 18472001) is methyl 2-amino-4,5-difluorobenzoate.
What is the SMILES notation for methyl 2-amino-4,5-difluorobenzoate?
The canonical SMILES for methyl 2-amino-4,5-difluorobenzoate is COC(=O)c1cc(F)c(F)cc1N.
What is the InChIKey of methyl 2-amino-4,5-difluorobenzoate?
The InChIKey is VIAQNTRKUPBQKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F2NO2/c1-13-8(12)4-2-5(9)6(10)3-7(4)11/h2-3H,11H2,1H3.
What are the key properties of methyl 2-amino-4,5-difluorobenzoate?
methyl 2-amino-4,5-difluorobenzoate has a molecular weight of 187.14 g/mol, XLogP of 1.33, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-amino-4,5-difluorobenzoate is sourced from PubChem (CID 18472001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).