C15H18NO7P — CID 18472790
2-[hydroxy-[1-(1H-indol-3-yl)ethyl]phosphoryl]oxypentanedioic acid (PubChem CID 18472790) has the molecular formula C15H18NO7P and a molecular weight of 355.28 g/mol. Its IUPAC name is 2-[hydroxy-[1-(1H-indol-3-yl)ethyl]phosphoryl]oxypentanedioic acid.
| Compound Name | 2-[hydroxy-[1-(1H-indol-3-yl)ethyl]phosphoryl]oxypentanedioic acid |
|---|---|
| PubChem CID | 18472790 |
| Molecular Formula | C15H18NO7P |
| Molecular Weight | 355.28 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 2-[hydroxy-[1-(1H-indol-3-yl)ethyl]phosphoryl]oxypentanedioic acid |
| SMILES | CC(c1c[nH]c2ccccc12)P(=O)(O)OC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C15H18NO7P/c1-9(11-8-16-12-5-3-2-4-10(11)12)24(21,22)23-13(15(19)20)6-7-14(17)18/h2-5,8-9,13,16H,6-7H2,1H3,(H,17,18)(H,19,20)(H,21,22) |
| InChIKey | ZZJMHXXFXWEKJV-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 136.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.28 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|