About 2-(4,6-diamino-2-methylsulfanylpyrimidin-5-yl)guanidine
2-(4,6-diamino-2-methylsulfanylpyrimidin-5-yl)guanidine (PubChem CID 18473225) has the molecular formula C6H11N7S
and a molecular weight of 213.27 g/mol. Its IUPAC name is 2-(4,6-diamino-2-methylsulfanylpyrimidin-5-yl)guanidine.
Molecular Properties
| Compound Name | 2-(4,6-diamino-2-methylsulfanylpyrimidin-5-yl)guanidine |
| PubChem CID | 18473225 |
| Molecular Formula | C6H11N7S |
| Molecular Weight | 213.27 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 2-(4,6-diamino-2-methylsulfanylpyrimidin-5-yl)guanidine |
| SMILES | CSc1nc(N)c(N=C(N)N)c(N)n1 |
| InChI | InChI=1S/C6H11N7S/c1-14-6-12-3(7)2(4(8)13-6)11-5(9)10/h1H3,(H4,9,10,11)(H4,7,8,12,13) |
| InChIKey | BYNATVSEPLZKAO-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 142.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.27 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,6-diamino-2-methylsulfanylpyrimidin-5-yl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,6-diamino-2-methylsulfanylpyrimidin-5-yl)guanidine?
The IUPAC name of 2-(4,6-diamino-2-methylsulfanylpyrimidin-5-yl)guanidine (CID 18473225) is 2-(4,6-diamino-2-methylsulfanylpyrimidin-5-yl)guanidine.
What is the SMILES notation for 2-(4,6-diamino-2-methylsulfanylpyrimidin-5-yl)guanidine?
The canonical SMILES for 2-(4,6-diamino-2-methylsulfanylpyrimidin-5-yl)guanidine is CSc1nc(N)c(N=C(N)N)c(N)n1.
What is the InChIKey of 2-(4,6-diamino-2-methylsulfanylpyrimidin-5-yl)guanidine?
The InChIKey is BYNATVSEPLZKAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N7S/c1-14-6-12-3(7)2(4(8)13-6)11-5(9)10/h1H3,(H4,9,10,11)(H4,7,8,12,13).
What are the key properties of 2-(4,6-diamino-2-methylsulfanylpyrimidin-5-yl)guanidine?
2-(4,6-diamino-2-methylsulfanylpyrimidin-5-yl)guanidine has a molecular weight of 213.27 g/mol, XLogP of -0.73, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,6-diamino-2-methylsulfanylpyrimidin-5-yl)guanidine is sourced from PubChem (CID 18473225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).