About 4-(6-chloro-2,3-dihydroindol-1-yl)-7H-pyrrolo[2,3-d]pyrimidine
4-(6-chloro-2,3-dihydroindol-1-yl)-7H-pyrrolo[2,3-d]pyrimidine (PubChem CID 18473274) has the molecular formula C14H11ClN4
and a molecular weight of 270.72 g/mol. Its IUPAC name is 4-(6-chloro-2,3-dihydroindol-1-yl)-7H-pyrrolo[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 4-(6-chloro-2,3-dihydroindol-1-yl)-7H-pyrrolo[2,3-d]pyrimidine |
| PubChem CID | 18473274 |
| Molecular Formula | C14H11ClN4 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 4-(6-chloro-2,3-dihydroindol-1-yl)-7H-pyrrolo[2,3-d]pyrimidine |
| SMILES | Clc1ccc2c(c1)N(c1ncnc3[nH]ccc13)CC2 |
| InChI | InChI=1S/C14H11ClN4/c15-10-2-1-9-4-6-19(12(9)7-10)14-11-3-5-16-13(11)17-8-18-14/h1-3,5,7-8H,4,6H2,(H,16,17,18) |
| InChIKey | QFWXJNYIINNXFM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(6-chloro-2,3-dihydroindol-1-yl)-7H-pyrrolo[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-chloro-2,3-dihydroindol-1-yl)-7H-pyrrolo[2,3-d]pyrimidine?
The IUPAC name of 4-(6-chloro-2,3-dihydroindol-1-yl)-7H-pyrrolo[2,3-d]pyrimidine (CID 18473274) is 4-(6-chloro-2,3-dihydroindol-1-yl)-7H-pyrrolo[2,3-d]pyrimidine.
What is the SMILES notation for 4-(6-chloro-2,3-dihydroindol-1-yl)-7H-pyrrolo[2,3-d]pyrimidine?
The canonical SMILES for 4-(6-chloro-2,3-dihydroindol-1-yl)-7H-pyrrolo[2,3-d]pyrimidine is Clc1ccc2c(c1)N(c1ncnc3[nH]ccc13)CC2.
What is the InChIKey of 4-(6-chloro-2,3-dihydroindol-1-yl)-7H-pyrrolo[2,3-d]pyrimidine?
The InChIKey is QFWXJNYIINNXFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11ClN4/c15-10-2-1-9-4-6-19(12(9)7-10)14-11-3-5-16-13(11)17-8-18-14/h1-3,5,7-8H,4,6H2,(H,16,17,18).
What are the key properties of 4-(6-chloro-2,3-dihydroindol-1-yl)-7H-pyrrolo[2,3-d]pyrimidine?
4-(6-chloro-2,3-dihydroindol-1-yl)-7H-pyrrolo[2,3-d]pyrimidine has a molecular weight of 270.72 g/mol, XLogP of 3.31, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-chloro-2,3-dihydroindol-1-yl)-7H-pyrrolo[2,3-d]pyrimidine is sourced from PubChem (CID 18473274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).