About 5,6-diamino-1-ethyl-2-sulfanylidenepyrimidin-4-one;hydrochloride
5,6-diamino-1-ethyl-2-sulfanylidenepyrimidin-4-one;hydrochloride (PubChem CID 18473538) has the molecular formula C6H11ClN4OS
and a molecular weight of 222.70 g/mol. Its IUPAC name is 5,6-diamino-1-ethyl-2-sulfanylidenepyrimidin-4-one;hydrochloride.
Molecular Properties
| Compound Name | 5,6-diamino-1-ethyl-2-sulfanylidenepyrimidin-4-one;hydrochloride |
| PubChem CID | 18473538 |
| Molecular Formula | C6H11ClN4OS |
| Molecular Weight | 222.70 g/mol |
| Exact Mass | 222.03 |
| IUPAC Name | 5,6-diamino-1-ethyl-2-sulfanylidenepyrimidin-4-one;hydrochloride |
| SMILES | CCn1c(N)c(N)c(=O)[nH]c1=S.Cl |
| InChI | InChI=1S/C6H10N4OS.ClH/c1-2-10-4(8)3(7)5(11)9-6(10)12;/h2,7-8H2,1H3,(H,9,11,12);1H |
| InChIKey | PKBDFAHCYUDCHE-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 89.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.70 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5,6-diamino-1-ethyl-2-sulfanylidenepyrimidin-4-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-diamino-1-ethyl-2-sulfanylidenepyrimidin-4-one;hydrochloride?
The IUPAC name of 5,6-diamino-1-ethyl-2-sulfanylidenepyrimidin-4-one;hydrochloride (CID 18473538) is 5,6-diamino-1-ethyl-2-sulfanylidenepyrimidin-4-one;hydrochloride.
What is the SMILES notation for 5,6-diamino-1-ethyl-2-sulfanylidenepyrimidin-4-one;hydrochloride?
The canonical SMILES for 5,6-diamino-1-ethyl-2-sulfanylidenepyrimidin-4-one;hydrochloride is CCn1c(N)c(N)c(=O)[nH]c1=S.Cl.
What is the InChIKey of 5,6-diamino-1-ethyl-2-sulfanylidenepyrimidin-4-one;hydrochloride?
The InChIKey is PKBDFAHCYUDCHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4OS.ClH/c1-2-10-4(8)3(7)5(11)9-6(10)12;/h2,7-8H2,1H3,(H,9,11,12);1H.
What are the key properties of 5,6-diamino-1-ethyl-2-sulfanylidenepyrimidin-4-one;hydrochloride?
5,6-diamino-1-ethyl-2-sulfanylidenepyrimidin-4-one;hydrochloride has a molecular weight of 222.70 g/mol, XLogP of 0.51, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-diamino-1-ethyl-2-sulfanylidenepyrimidin-4-one;hydrochloride is sourced from PubChem (CID 18473538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).