About 1,1'-biphenyl;4,5-dihydro-1,3-oxazole
1,1'-biphenyl;4,5-dihydro-1,3-oxazole (PubChem CID 18473876) has the molecular formula C15H15NO
and a molecular weight of 225.29 g/mol. Its IUPAC name is 1,1'-biphenyl;4,5-dihydro-1,3-oxazole.
Molecular Properties
| Compound Name | 1,1'-biphenyl;4,5-dihydro-1,3-oxazole |
| PubChem CID | 18473876 |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 1,1'-biphenyl;4,5-dihydro-1,3-oxazole |
| SMILES | C1=NCCO1.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C3H5NO/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-5-3-4-1/h1-10H;3H,1-2H2 |
| InChIKey | YEBXJRBNPTUQKG-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,1'-biphenyl;4,5-dihydro-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;4,5-dihydro-1,3-oxazole?
The IUPAC name of 1,1'-biphenyl;4,5-dihydro-1,3-oxazole (CID 18473876) is 1,1'-biphenyl;4,5-dihydro-1,3-oxazole.
What is the SMILES notation for 1,1'-biphenyl;4,5-dihydro-1,3-oxazole?
The canonical SMILES for 1,1'-biphenyl;4,5-dihydro-1,3-oxazole is C1=NCCO1.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;4,5-dihydro-1,3-oxazole?
The InChIKey is YEBXJRBNPTUQKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.C3H5NO/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-5-3-4-1/h1-10H;3H,1-2H2.
What are the key properties of 1,1'-biphenyl;4,5-dihydro-1,3-oxazole?
1,1'-biphenyl;4,5-dihydro-1,3-oxazole has a molecular weight of 225.29 g/mol, XLogP of 3.40, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;4,5-dihydro-1,3-oxazole is sourced from PubChem (CID 18473876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).