About 2,6-ditert-butyl-4-[(dimethylamino)methyl]cyclohexa-2,4-dien-1-one
2,6-ditert-butyl-4-[(dimethylamino)methyl]cyclohexa-2,4-dien-1-one (PubChem CID 18475157) has the molecular formula C17H29NO
and a molecular weight of 263.42 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[(dimethylamino)methyl]cyclohexa-2,4-dien-1-one.
Molecular Properties
| Compound Name | 2,6-ditert-butyl-4-[(dimethylamino)methyl]cyclohexa-2,4-dien-1-one |
| PubChem CID | 18475157 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.42 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | 2,6-ditert-butyl-4-[(dimethylamino)methyl]cyclohexa-2,4-dien-1-one |
| SMILES | CN(C)CC1=CC(C(C)(C)C)C(=O)C(C(C)(C)C)=C1 |
| InChI | InChI=1S/C17H29NO/c1-16(2,3)13-9-12(11-18(7)8)10-14(15(13)19)17(4,5)6/h9-10,13H,11H2,1-8H3 |
| InChIKey | KDZVRZNYTBCMAY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.42 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,6-ditert-butyl-4-[(dimethylamino)methyl]cyclohexa-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-ditert-butyl-4-[(dimethylamino)methyl]cyclohexa-2,4-dien-1-one?
The IUPAC name of 2,6-ditert-butyl-4-[(dimethylamino)methyl]cyclohexa-2,4-dien-1-one (CID 18475157) is 2,6-ditert-butyl-4-[(dimethylamino)methyl]cyclohexa-2,4-dien-1-one.
What is the SMILES notation for 2,6-ditert-butyl-4-[(dimethylamino)methyl]cyclohexa-2,4-dien-1-one?
The canonical SMILES for 2,6-ditert-butyl-4-[(dimethylamino)methyl]cyclohexa-2,4-dien-1-one is CN(C)CC1=CC(C(C)(C)C)C(=O)C(C(C)(C)C)=C1.
What is the InChIKey of 2,6-ditert-butyl-4-[(dimethylamino)methyl]cyclohexa-2,4-dien-1-one?
The InChIKey is KDZVRZNYTBCMAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29NO/c1-16(2,3)13-9-12(11-18(7)8)10-14(15(13)19)17(4,5)6/h9-10,13H,11H2,1-8H3.
What are the key properties of 2,6-ditert-butyl-4-[(dimethylamino)methyl]cyclohexa-2,4-dien-1-one?
2,6-ditert-butyl-4-[(dimethylamino)methyl]cyclohexa-2,4-dien-1-one has a molecular weight of 263.42 g/mol, XLogP of 3.69, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-ditert-butyl-4-[(dimethylamino)methyl]cyclohexa-2,4-dien-1-one is sourced from PubChem (CID 18475157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).