C14H11NO6S — CID 18475308
3-(1,1,3-trioxo-1,2-benzothiazole-2-carbonyl)cyclohexane-1,2-dione (PubChem CID 18475308) has the molecular formula C14H11NO6S and a molecular weight of 321.31 g/mol. Its IUPAC name is 3-(1,1,3-trioxo-1,2-benzothiazole-2-carbonyl)cyclohexane-1,2-dione.
| Compound Name | 3-(1,1,3-trioxo-1,2-benzothiazole-2-carbonyl)cyclohexane-1,2-dione |
|---|---|
| PubChem CID | 18475308 |
| Molecular Formula | C14H11NO6S |
| Molecular Weight | 321.31 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | 3-(1,1,3-trioxo-1,2-benzothiazole-2-carbonyl)cyclohexane-1,2-dione |
| SMILES | O=C1CCCC(C(=O)N2C(=O)c3ccccc3S2(=O)=O)C1=O |
| InChI | InChI=1S/C14H11NO6S/c16-10-6-3-5-9(12(10)17)14(19)15-13(18)8-4-1-2-7-11(8)22(15,20)21/h1-2,4,7,9H,3,5-6H2 |
| InChIKey | VGQXQFWRTGRBPO-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 105.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.31 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|