About (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl carbonochloridate
(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl carbonochloridate (PubChem CID 18475375) has the molecular formula C6H5ClO5
and a molecular weight of 192.55 g/mol. Its IUPAC name is (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl carbonochloridate.
Molecular Properties
| Compound Name | (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl carbonochloridate |
| PubChem CID | 18475375 |
| Molecular Formula | C6H5ClO5 |
| Molecular Weight | 192.55 g/mol |
| Exact Mass | 191.98 |
| IUPAC Name | (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl carbonochloridate |
| SMILES | Cc1oc(=O)oc1COC(=O)Cl |
| InChI | InChI=1S/C6H5ClO5/c1-3-4(2-10-5(7)8)12-6(9)11-3/h2H2,1H3 |
| InChIKey | GGZNXADHWLJYJR-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 69.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.55 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl carbonochloridate?
The IUPAC name of (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl carbonochloridate (CID 18475375) is (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl carbonochloridate.
What is the SMILES notation for (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl carbonochloridate?
The canonical SMILES for (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl carbonochloridate is Cc1oc(=O)oc1COC(=O)Cl.
What is the InChIKey of (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl carbonochloridate?
The InChIKey is GGZNXADHWLJYJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5ClO5/c1-3-4(2-10-5(7)8)12-6(9)11-3/h2H2,1H3.
What are the key properties of (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl carbonochloridate?
(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl carbonochloridate has a molecular weight of 192.55 g/mol, XLogP of 1.42, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl carbonochloridate is sourced from PubChem (CID 18475375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).