About 3-(4,5-dihydro-1H-imidazol-2-yl)-2-methyl-5-phenyl-1H-indole;hydrochloride
3-(4,5-dihydro-1H-imidazol-2-yl)-2-methyl-5-phenyl-1H-indole;hydrochloride (PubChem CID 18476272) has the molecular formula C18H18ClN3
and a molecular weight of 311.82 g/mol. Its IUPAC name is 3-(4,5-dihydro-1H-imidazol-2-yl)-2-methyl-5-phenyl-1H-indole;hydrochloride.
Molecular Properties
| Compound Name | 3-(4,5-dihydro-1H-imidazol-2-yl)-2-methyl-5-phenyl-1H-indole;hydrochloride |
| PubChem CID | 18476272 |
| Molecular Formula | C18H18ClN3 |
| Molecular Weight | 311.82 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 3-(4,5-dihydro-1H-imidazol-2-yl)-2-methyl-5-phenyl-1H-indole;hydrochloride |
| SMILES | Cc1[nH]c2ccc(-c3ccccc3)cc2c1C1=NCCN1.Cl |
| InChI | InChI=1S/C18H17N3.ClH/c1-12-17(18-19-9-10-20-18)15-11-14(7-8-16(15)21-12)13-5-3-2-4-6-13;/h2-8,11,21H,9-10H2,1H3,(H,19,20);1H |
| InChIKey | LHTVGPZFVKXSRB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.82 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(4,5-dihydro-1H-imidazol-2-yl)-2-methyl-5-phenyl-1H-indole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,5-dihydro-1H-imidazol-2-yl)-2-methyl-5-phenyl-1H-indole;hydrochloride?
The IUPAC name of 3-(4,5-dihydro-1H-imidazol-2-yl)-2-methyl-5-phenyl-1H-indole;hydrochloride (CID 18476272) is 3-(4,5-dihydro-1H-imidazol-2-yl)-2-methyl-5-phenyl-1H-indole;hydrochloride.
What is the SMILES notation for 3-(4,5-dihydro-1H-imidazol-2-yl)-2-methyl-5-phenyl-1H-indole;hydrochloride?
The canonical SMILES for 3-(4,5-dihydro-1H-imidazol-2-yl)-2-methyl-5-phenyl-1H-indole;hydrochloride is Cc1[nH]c2ccc(-c3ccccc3)cc2c1C1=NCCN1.Cl.
What is the InChIKey of 3-(4,5-dihydro-1H-imidazol-2-yl)-2-methyl-5-phenyl-1H-indole;hydrochloride?
The InChIKey is LHTVGPZFVKXSRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3.ClH/c1-12-17(18-19-9-10-20-18)15-11-14(7-8-16(15)21-12)13-5-3-2-4-6-13;/h2-8,11,21H,9-10H2,1H3,(H,19,20);1H.
What are the key properties of 3-(4,5-dihydro-1H-imidazol-2-yl)-2-methyl-5-phenyl-1H-indole;hydrochloride?
3-(4,5-dihydro-1H-imidazol-2-yl)-2-methyl-5-phenyl-1H-indole;hydrochloride has a molecular weight of 311.82 g/mol, XLogP of 3.91, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,5-dihydro-1H-imidazol-2-yl)-2-methyl-5-phenyl-1H-indole;hydrochloride is sourced from PubChem (CID 18476272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).