C16H12N4O2 — CID 18477617
2-[(1R)-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]isoindole-1,3-dione (PubChem CID 18477617) has the molecular formula C16H12N4O2 and a molecular weight of 292.30 g/mol. Its IUPAC name is 2-[(1R)-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]isoindole-1,3-dione.
| Compound Name | 2-[(1R)-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 18477617 |
| Molecular Formula | C16H12N4O2 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 2-[(1R)-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]isoindole-1,3-dione |
| SMILES | C[C@H](c1nnc2ccccn12)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H12N4O2/c1-10(14-18-17-13-8-4-5-9-19(13)14)20-15(21)11-6-2-3-7-12(11)16(20)22/h2-10H,1H3/t10-/m1/s1 |
| InChIKey | WAGZHLJXGJWFGT-SNVBAGLBSA-N |
| XLogP | 2.09 |
| TPSA | 67.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|