C13H19IN2O — CID 18477681
iodomethane;(1S,9R)-11-methyl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 18477681) has the molecular formula C13H19IN2O and a molecular weight of 346.21 g/mol. Its IUPAC name is iodomethane;(1S,9R)-11-methyl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | iodomethane;(1S,9R)-11-methyl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 18477681 |
| Molecular Formula | C13H19IN2O |
| Molecular Weight | 346.21 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | iodomethane;(1S,9R)-11-methyl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | CI.CN1C[C@H]2C[C@@H](C1)c1cccc(=O)n1C2 |
| InChI | InChI=1S/C12H16N2O.CH3I/c1-13-6-9-5-10(8-13)11-3-2-4-12(15)14(11)7-9;1-2/h2-4,9-10H,5-8H2,1H3;1H3/t9-,10+;/m1./s1 |
| InChIKey | JASQVKFOAJUBRJ-UXQCFNEQSA-N |
| XLogP | 1.95 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.21 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|