C14H22N4O9S — CID 18486817
2-[[2-[[2-[(2-aminoacetyl)amino]-4-carboxybutanoyl]amino]-3-sulfanylpropanoyl]amino]butanedioic acid (PubChem CID 18486817) has the molecular formula C14H22N4O9S and a molecular weight of 422.42 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-aminoacetyl)amino]-4-carboxybutanoyl]amino]-3-sulfanylpropanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[2-[(2-aminoacetyl)amino]-4-carboxybutanoyl]amino]-3-sulfanylpropanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18486817 |
| Molecular Formula | C14H22N4O9S |
| Molecular Weight | 422.42 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 2-[[2-[[2-[(2-aminoacetyl)amino]-4-carboxybutanoyl]amino]-3-sulfanylpropanoyl]amino]butanedioic acid |
| SMILES | NCC(=O)NC(CCC(=O)O)C(=O)NC(CS)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C14H22N4O9S/c15-4-9(19)16-6(1-2-10(20)21)12(24)18-8(5-28)13(25)17-7(14(26)27)3-11(22)23/h6-8,28H,1-5,15H2,(H,16,19)(H,17,25)(H,18,24)(H,20,21)(H,22,23)(H,26,27) |
| InChIKey | YDYYJJVTMDGTTC-UHFFFAOYSA-N |
| XLogP | -3.25 |
| TPSA | 225.22 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.42 |
| LogP ≤ 5 | -3.25 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|