About 4-chloro-2-methylaniline;hydrochloride
4-chloro-2-methylaniline;hydrochloride (PubChem CID 18487) has the molecular formula C7H9Cl2N
and a molecular weight of 178.06 g/mol. Its IUPAC name is 4-chloro-2-methylaniline;hydrochloride.
Molecular Properties
| Compound Name | 4-chloro-2-methylaniline;hydrochloride |
| PubChem CID | 18487 |
| Molecular Formula | C7H9Cl2N |
| Molecular Weight | 178.06 g/mol |
| Exact Mass | 177.01 |
| IUPAC Name | 4-chloro-2-methylaniline;hydrochloride |
| SMILES | Cc1cc(Cl)ccc1N.Cl |
| InChI | InChI=1S/C7H8ClN.ClH/c1-5-4-6(8)2-3-7(5)9;/h2-4H,9H2,1H3;1H |
| InChIKey | VKYZDCTWJGBFDW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.06 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2-methylaniline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-methylaniline;hydrochloride?
The IUPAC name of 4-chloro-2-methylaniline;hydrochloride (CID 18487) is 4-chloro-2-methylaniline;hydrochloride.
What is the SMILES notation for 4-chloro-2-methylaniline;hydrochloride?
The canonical SMILES for 4-chloro-2-methylaniline;hydrochloride is Cc1cc(Cl)ccc1N.Cl.
What is the InChIKey of 4-chloro-2-methylaniline;hydrochloride?
The InChIKey is VKYZDCTWJGBFDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8ClN.ClH/c1-5-4-6(8)2-3-7(5)9;/h2-4H,9H2,1H3;1H.
What are the key properties of 4-chloro-2-methylaniline;hydrochloride?
4-chloro-2-methylaniline;hydrochloride has a molecular weight of 178.06 g/mol, XLogP of 2.65, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-methylaniline;hydrochloride is sourced from PubChem (CID 18487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).