C23H27N7O7 — CID 18493986
3-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-4-[[2-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]amino]-4-oxobutanoic acid (PubChem CID 18493986) has the molecular formula C23H27N7O7 and a molecular weight of 513.51 g/mol. Its IUPAC name is 3-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-4-[[2-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]amino]-4-oxobutanoic acid.
| Compound Name | 3-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-4-[[2-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18493986 |
| Molecular Formula | C23H27N7O7 |
| Molecular Weight | 513.51 g/mol |
| Exact Mass | 513.20 |
| IUPAC Name | 3-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-4-[[2-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]amino]-4-oxobutanoic acid |
| SMILES | NC(Cc1cnc[nH]1)C(=O)NC(CC(=O)O)C(=O)NCC(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C23H27N7O7/c24-15(6-13-9-25-11-28-13)21(34)30-17(7-20(32)33)22(35)27-10-19(31)29-18(23(36)37)5-12-8-26-16-4-2-1-3-14(12)16/h1-4,8-9,11,15,17-18,26H,5-7,10,24H2,(H,25,28)(H,27,35)(H,29,31)(H,30,34)(H,32,33)(H,36,37) |
| InChIKey | UHEDLVVPNIXXDZ-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 232.39 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.51 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |