C19H33N9O6S — CID 18494265
2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoic acid (PubChem CID 18494265) has the molecular formula C19H33N9O6S and a molecular weight of 515.60 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 18494265 |
| Molecular Formula | C19H33N9O6S |
| Molecular Weight | 515.60 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoic acid |
| SMILES | CC(O)C(NC(=O)C(CCCN=C(N)N)NC(=O)C(CS)NC(=O)C(N)Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C19H33N9O6S/c1-9(29)14(18(33)34)28-16(31)12(3-2-4-24-19(21)22)26-17(32)13(7-35)27-15(30)11(20)5-10-6-23-8-25-10/h6,8-9,11-14,29,35H,2-5,7,20H2,1H3,(H,23,25)(H,26,32)(H,27,30)(H,28,31)(H,33,34)(H4,21,22,24) |
| InChIKey | CSCAHJHVJXWHEQ-UHFFFAOYSA-N |
| XLogP | -3.82 |
| TPSA | 263.93 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.60 |
| LogP ≤ 5 | -3.82 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|