C25H31N7O7S — CID 18494573
2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]pentanedioic acid (PubChem CID 18494573) has the molecular formula C25H31N7O7S and a molecular weight of 573.63 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18494573 |
| Molecular Formula | C25H31N7O7S |
| Molecular Weight | 573.63 g/mol |
| Exact Mass | 573.20 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]pentanedioic acid |
| SMILES | NC(Cc1cnc[nH]1)C(=O)NC(CS)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C25H31N7O7S/c26-16(8-14-10-27-12-29-14)22(35)32-20(11-40)24(37)31-19(7-13-9-28-17-4-2-1-3-15(13)17)23(36)30-18(25(38)39)5-6-21(33)34/h1-4,9-10,12,16,18-20,28,40H,5-8,11,26H2,(H,27,29)(H,30,36)(H,31,37)(H,32,35)(H,33,34)(H,38,39) |
| InChIKey | PQLBSSCOJFUXRW-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 232.39 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.63 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|