C24H34N6O6S — CID 18494597
2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylpentanoic acid (PubChem CID 18494597) has the molecular formula C24H34N6O6S and a molecular weight of 534.64 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 18494597 |
| Molecular Formula | C24H34N6O6S |
| Molecular Weight | 534.64 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(CS)NC(=O)C(N)Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C24H34N6O6S/c1-3-13(2)20(24(35)36)30-22(33)18(8-14-4-6-16(31)7-5-14)28-23(34)19(11-37)29-21(32)17(25)9-15-10-26-12-27-15/h4-7,10,12-13,17-20,31,37H,3,8-9,11,25H2,1-2H3,(H,26,27)(H,28,34)(H,29,32)(H,30,33)(H,35,36) |
| InChIKey | HJFIFMFWQPAZQK-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 199.53 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.64 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|