C21H33N7O8 — CID 18495209
2-[[2-[[5-amino-2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-5-oxopentanoyl]amino]-3-methylpentanoyl]amino]butanedioic acid (PubChem CID 18495209) has the molecular formula C21H33N7O8 and a molecular weight of 511.54 g/mol. Its IUPAC name is 2-[[2-[[5-amino-2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-5-oxopentanoyl]amino]-3-methylpentanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[5-amino-2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-5-oxopentanoyl]amino]-3-methylpentanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18495209 |
| Molecular Formula | C21H33N7O8 |
| Molecular Weight | 511.54 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | 2-[[2-[[5-amino-2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-5-oxopentanoyl]amino]-3-methylpentanoyl]amino]butanedioic acid |
| SMILES | CCC(C)C(NC(=O)C(CCC(N)=O)NC(=O)C(N)Cc1cnc[nH]1)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C21H33N7O8/c1-3-10(2)17(20(34)27-14(21(35)36)7-16(30)31)28-19(33)13(4-5-15(23)29)26-18(32)12(22)6-11-8-24-9-25-11/h8-10,12-14,17H,3-7,22H2,1-2H3,(H2,23,29)(H,24,25)(H,26,32)(H,27,34)(H,28,33)(H,30,31)(H,35,36) |
| InChIKey | PYLRKJUHSVOESL-UHFFFAOYSA-N |
| XLogP | -2.40 |
| TPSA | 259.69 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.54 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |