C28H37N7O7 — CID 18496341
4-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-methylpentanoyl]amino]-5-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-5-oxopentanoic acid (PubChem CID 18496341) has the molecular formula C28H37N7O7 and a molecular weight of 583.65 g/mol. Its IUPAC name is 4-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-methylpentanoyl]amino]-5-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-5-oxopentanoic acid.
| Compound Name | 4-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-methylpentanoyl]amino]-5-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18496341 |
| Molecular Formula | C28H37N7O7 |
| Molecular Weight | 583.65 g/mol |
| Exact Mass | 583.28 |
| IUPAC Name | 4-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-methylpentanoyl]amino]-5-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-5-oxopentanoic acid |
| SMILES | CCC(C)C(NC(=O)C(N)Cc1cnc[nH]1)C(=O)NC(CCC(=O)O)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C28H37N7O7/c1-3-15(2)24(35-25(38)19(29)11-17-13-30-14-32-17)27(40)33-21(8-9-23(36)37)26(39)34-22(28(41)42)10-16-12-31-20-7-5-4-6-18(16)20/h4-7,12-15,19,21-22,24,31H,3,8-11,29H2,1-2H3,(H,30,32)(H,33,40)(H,34,39)(H,35,38)(H,36,37)(H,41,42) |
| InChIKey | XUGPPYPZHGJBSX-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 232.39 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.65 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |