About 2-acetamidopentanedioic acid
2-acetamidopentanedioic acid (PubChem CID 185) has the molecular formula C7H11NO5
and a molecular weight of 189.17 g/mol. Its IUPAC name is 2-acetamidopentanedioic acid.
Molecular Properties
| Compound Name | 2-acetamidopentanedioic acid |
| PubChem CID | 185 |
| Molecular Formula | C7H11NO5 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | 2-acetamidopentanedioic acid |
| SMILES | CC(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C7H11NO5/c1-4(9)8-5(7(12)13)2-3-6(10)11/h5H,2-3H2,1H3,(H,8,9)(H,10,11)(H,12,13) |
| InChIKey | RFMMMVDNIPUKGG-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-acetamidopentanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetamidopentanedioic acid?
The IUPAC name of 2-acetamidopentanedioic acid (CID 185) is 2-acetamidopentanedioic acid.
What is the SMILES notation for 2-acetamidopentanedioic acid?
The canonical SMILES for 2-acetamidopentanedioic acid is CC(=O)NC(CCC(=O)O)C(=O)O.
What is the InChIKey of 2-acetamidopentanedioic acid?
The InChIKey is RFMMMVDNIPUKGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO5/c1-4(9)8-5(7(12)13)2-3-6(10)11/h5H,2-3H2,1H3,(H,8,9)(H,10,11)(H,12,13).
What are the key properties of 2-acetamidopentanedioic acid?
2-acetamidopentanedioic acid has a molecular weight of 189.17 g/mol, XLogP of -0.56, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetamidopentanedioic acid is sourced from PubChem (CID 185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).