C21H40N8O6 — CID 18501783
2-[[2-[[4-amino-2-[(2-amino-3-methylpentanoyl)amino]-4-oxobutanoyl]amino]-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18501783) has the molecular formula C21H40N8O6 and a molecular weight of 500.60 g/mol. Its IUPAC name is 2-[[2-[[4-amino-2-[(2-amino-3-methylpentanoyl)amino]-4-oxobutanoyl]amino]-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[[4-amino-2-[(2-amino-3-methylpentanoyl)amino]-4-oxobutanoyl]amino]-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18501783 |
| Molecular Formula | C21H40N8O6 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.31 |
| IUPAC Name | 2-[[2-[[4-amino-2-[(2-amino-3-methylpentanoyl)amino]-4-oxobutanoyl]amino]-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CCC(C)C(N)C(=O)NC(CC(N)=O)C(=O)NC(C(=O)NC(CCCN=C(N)N)C(=O)O)C(C)C |
| InChI | InChI=1S/C21H40N8O6/c1-5-11(4)15(23)18(32)28-13(9-14(22)30)17(31)29-16(10(2)3)19(33)27-12(20(34)35)7-6-8-26-21(24)25/h10-13,15-16H,5-9,23H2,1-4H3,(H2,22,30)(H,27,33)(H,28,32)(H,29,31)(H,34,35)(H4,24,25,26) |
| InChIKey | RRFAPIKXIRMJHA-UHFFFAOYSA-N |
| XLogP | -2.52 |
| TPSA | 258.11 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | -2.52 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|