C17H30INO3 — CID 18502834
[(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-(4-methylmorpholin-4-ium-4-yl)acetate iodide (PubChem CID 18502834) has the molecular formula C17H30INO3 and a molecular weight of 423.34 g/mol. Its IUPAC name is [(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-(4-methylmorpholin-4-ium-4-yl)acetate iodide.
| Compound Name | [(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-(4-methylmorpholin-4-ium-4-yl)acetate iodide |
|---|---|
| PubChem CID | 18502834 |
| Molecular Formula | C17H30INO3 |
| Molecular Weight | 423.34 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | [(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-(4-methylmorpholin-4-ium-4-yl)acetate iodide |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)[C@@H](OC(=O)C[N+]1(C)CCOCC1)C2.[I-] |
| InChI | InChI=1S/C17H30NO3.HI/c1-16(2)13-5-6-17(16,3)14(11-13)21-15(19)12-18(4)7-9-20-10-8-18;/h13-14H,5-12H2,1-4H3;1H/q+1;/p-1/t13-,14-,17+;/m0./s1 |
| InChIKey | MBGRCRBYHDCELJ-ZUZBSIPJSA-M |
| XLogP | -0.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.34 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|