C13H22O4S3Sn — CID 18503074
2,2-dibutyl-7-sulfanylidene-1,3,6,8,2-dioxadithiastannecane-4,10-dione (PubChem CID 18503074) has the molecular formula C13H22O4S3Sn and a molecular weight of 457.23 g/mol. Its IUPAC name is 2,2-dibutyl-7-sulfanylidene-1,3,6,8,2-dioxadithiastannecane-4,10-dione.
| Compound Name | 2,2-dibutyl-7-sulfanylidene-1,3,6,8,2-dioxadithiastannecane-4,10-dione |
|---|---|
| PubChem CID | 18503074 |
| Molecular Formula | C13H22O4S3Sn |
| Molecular Weight | 457.23 g/mol |
| Exact Mass | 457.97 |
| IUPAC Name | 2,2-dibutyl-7-sulfanylidene-1,3,6,8,2-dioxadithiastannecane-4,10-dione |
| SMILES | CCCC[Sn]1(CCCC)OC(=O)CSC(=S)SCC(=O)O1 |
| InChI | InChI=1S/C5H6O4S3.2C4H9.Sn/c6-3(7)1-11-5(10)12-2-4(8)9;2*1-3-4-2;/h1-2H2,(H,6,7)(H,8,9);2*1,3-4H2,2H3;/q;;;+2/p-2 |
| InChIKey | BALFJBQNCKTVBX-UHFFFAOYSA-L |
| XLogP | 3.88 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.23 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|