C7H13F5O3Si — CID 18504294
trimethoxy(1,2,3,4,4-pentafluorobutyl)silane (PubChem CID 18504294) has the molecular formula C7H13F5O3Si and a molecular weight of 268.25 g/mol. Its IUPAC name is trimethoxy(1,2,3,4,4-pentafluorobutyl)silane.
| Compound Name | trimethoxy(1,2,3,4,4-pentafluorobutyl)silane |
|---|---|
| PubChem CID | 18504294 |
| Molecular Formula | C7H13F5O3Si |
| Molecular Weight | 268.25 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | trimethoxy(1,2,3,4,4-pentafluorobutyl)silane |
| SMILES | CO[Si](OC)(OC)C(F)C(F)C(F)C(F)F |
| InChI | InChI=1S/C7H13F5O3Si/c1-13-16(14-2,15-3)7(12)5(9)4(8)6(10)11/h4-7H,1-3H3 |
| InChIKey | HOUDOCSFHURXLK-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.25 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|