About 3-ethylpyrrole-2,5-dione;2-methylprop-1-ene
3-ethylpyrrole-2,5-dione;2-methylprop-1-ene (PubChem CID 18504405) has the molecular formula C10H15NO2
and a molecular weight of 181.23 g/mol. Its IUPAC name is 3-ethylpyrrole-2,5-dione;2-methylprop-1-ene.
Molecular Properties
| Compound Name | 3-ethylpyrrole-2,5-dione;2-methylprop-1-ene |
| PubChem CID | 18504405 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 3-ethylpyrrole-2,5-dione;2-methylprop-1-ene |
| SMILES | C=C(C)C.CCC1=CC(=O)NC1=O |
| InChI | InChI=1S/C6H7NO2.C4H8/c1-2-4-3-5(8)7-6(4)9;1-4(2)3/h3H,2H2,1H3,(H,7,8,9);1H2,2-3H3 |
| InChIKey | WAPPBQVYSLEFKP-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-ethylpyrrole-2,5-dione;2-methylprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylpyrrole-2,5-dione;2-methylprop-1-ene?
The IUPAC name of 3-ethylpyrrole-2,5-dione;2-methylprop-1-ene (CID 18504405) is 3-ethylpyrrole-2,5-dione;2-methylprop-1-ene.
What is the SMILES notation for 3-ethylpyrrole-2,5-dione;2-methylprop-1-ene?
The canonical SMILES for 3-ethylpyrrole-2,5-dione;2-methylprop-1-ene is C=C(C)C.CCC1=CC(=O)NC1=O.
What is the InChIKey of 3-ethylpyrrole-2,5-dione;2-methylprop-1-ene?
The InChIKey is WAPPBQVYSLEFKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO2.C4H8/c1-2-4-3-5(8)7-6(4)9;1-4(2)3/h3H,2H2,1H3,(H,7,8,9);1H2,2-3H3.
What are the key properties of 3-ethylpyrrole-2,5-dione;2-methylprop-1-ene?
3-ethylpyrrole-2,5-dione;2-methylprop-1-ene has a molecular weight of 181.23 g/mol, XLogP of 1.56, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylpyrrole-2,5-dione;2-methylprop-1-ene is sourced from PubChem (CID 18504405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).