About 2,3-dipropylpyrazolo[1,5-a]pyrimidin-7-amine
2,3-dipropylpyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 18504777) has the molecular formula C12H18N4
and a molecular weight of 218.30 g/mol. Its IUPAC name is 2,3-dipropylpyrazolo[1,5-a]pyrimidin-7-amine.
Molecular Properties
| Compound Name | 2,3-dipropylpyrazolo[1,5-a]pyrimidin-7-amine |
| PubChem CID | 18504777 |
| Molecular Formula | C12H18N4 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 2,3-dipropylpyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CCCc1nn2c(N)ccnc2c1CCC |
| InChI | InChI=1S/C12H18N4/c1-3-5-9-10(6-4-2)15-16-11(13)7-8-14-12(9)16/h7-8H,3-6,13H2,1-2H3 |
| InChIKey | UGOVBLUDFJRXEG-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,3-dipropylpyrazolo[1,5-a]pyrimidin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dipropylpyrazolo[1,5-a]pyrimidin-7-amine?
The IUPAC name of 2,3-dipropylpyrazolo[1,5-a]pyrimidin-7-amine (CID 18504777) is 2,3-dipropylpyrazolo[1,5-a]pyrimidin-7-amine.
What is the SMILES notation for 2,3-dipropylpyrazolo[1,5-a]pyrimidin-7-amine?
The canonical SMILES for 2,3-dipropylpyrazolo[1,5-a]pyrimidin-7-amine is CCCc1nn2c(N)ccnc2c1CCC.
What is the InChIKey of 2,3-dipropylpyrazolo[1,5-a]pyrimidin-7-amine?
The InChIKey is UGOVBLUDFJRXEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4/c1-3-5-9-10(6-4-2)15-16-11(13)7-8-14-12(9)16/h7-8H,3-6,13H2,1-2H3.
What are the key properties of 2,3-dipropylpyrazolo[1,5-a]pyrimidin-7-amine?
2,3-dipropylpyrazolo[1,5-a]pyrimidin-7-amine has a molecular weight of 218.30 g/mol, XLogP of 2.22, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dipropylpyrazolo[1,5-a]pyrimidin-7-amine is sourced from PubChem (CID 18504777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).