About 2-N'-ethylimidazole-2,2-diamine
2-N'-ethylimidazole-2,2-diamine (PubChem CID 18504978) has the molecular formula C5H10N4
and a molecular weight of 126.16 g/mol. Its IUPAC name is 2-N'-ethylimidazole-2,2-diamine.
Molecular Properties
| Compound Name | 2-N'-ethylimidazole-2,2-diamine |
| PubChem CID | 18504978 |
| Molecular Formula | C5H10N4 |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.09 |
| IUPAC Name | 2-N'-ethylimidazole-2,2-diamine |
| SMILES | CCNC1(N)N=CC=N1 |
| InChI | InChI=1S/C5H10N4/c1-2-7-5(6)8-3-4-9-5/h3-4,7H,2,6H2,1H3 |
| InChIKey | UVLLPERJDBXPAX-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-N'-ethylimidazole-2,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N'-ethylimidazole-2,2-diamine?
The IUPAC name of 2-N'-ethylimidazole-2,2-diamine (CID 18504978) is 2-N'-ethylimidazole-2,2-diamine.
What is the SMILES notation for 2-N'-ethylimidazole-2,2-diamine?
The canonical SMILES for 2-N'-ethylimidazole-2,2-diamine is CCNC1(N)N=CC=N1.
What is the InChIKey of 2-N'-ethylimidazole-2,2-diamine?
The InChIKey is UVLLPERJDBXPAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N4/c1-2-7-5(6)8-3-4-9-5/h3-4,7H,2,6H2,1H3.
What are the key properties of 2-N'-ethylimidazole-2,2-diamine?
2-N'-ethylimidazole-2,2-diamine has a molecular weight of 126.16 g/mol, XLogP of -0.68, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N'-ethylimidazole-2,2-diamine is sourced from PubChem (CID 18504978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).