About 3-[(4-methyl-1-nitroacridin-9-yl)amino]propyl propanoate;hydrochloride
3-[(4-methyl-1-nitroacridin-9-yl)amino]propyl propanoate;hydrochloride (PubChem CID 18505074) has the molecular formula C20H22ClN3O4
and a molecular weight of 403.87 g/mol. Its IUPAC name is 3-[(4-methyl-1-nitroacridin-9-yl)amino]propyl propanoate;hydrochloride.
Molecular Properties
| Compound Name | 3-[(4-methyl-1-nitroacridin-9-yl)amino]propyl propanoate;hydrochloride |
| PubChem CID | 18505074 |
| Molecular Formula | C20H22ClN3O4 |
| Molecular Weight | 403.87 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | 3-[(4-methyl-1-nitroacridin-9-yl)amino]propyl propanoate;hydrochloride |
| SMILES | CCC(=O)OCCCNc1c2ccccc2nc2c(C)ccc([N+](=O)[O-])c12.Cl |
| InChI | InChI=1S/C20H21N3O4.ClH/c1-3-17(24)27-12-6-11-21-20-14-7-4-5-8-15(14)22-19-13(2)9-10-16(18(19)20)23(25)26;/h4-5,7-10H,3,6,11-12H2,1-2H3,(H,21,22);1H |
| InChIKey | PVHOLVKOBYNRRS-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.87 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[(4-methyl-1-nitroacridin-9-yl)amino]propyl propanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-methyl-1-nitroacridin-9-yl)amino]propyl propanoate;hydrochloride?
The IUPAC name of 3-[(4-methyl-1-nitroacridin-9-yl)amino]propyl propanoate;hydrochloride (CID 18505074) is 3-[(4-methyl-1-nitroacridin-9-yl)amino]propyl propanoate;hydrochloride.
What is the SMILES notation for 3-[(4-methyl-1-nitroacridin-9-yl)amino]propyl propanoate;hydrochloride?
The canonical SMILES for 3-[(4-methyl-1-nitroacridin-9-yl)amino]propyl propanoate;hydrochloride is CCC(=O)OCCCNc1c2ccccc2nc2c(C)ccc([N+](=O)[O-])c12.Cl.
What is the InChIKey of 3-[(4-methyl-1-nitroacridin-9-yl)amino]propyl propanoate;hydrochloride?
The InChIKey is PVHOLVKOBYNRRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N3O4.ClH/c1-3-17(24)27-12-6-11-21-20-14-7-4-5-8-15(14)22-19-13(2)9-10-16(18(19)20)23(25)26;/h4-5,7-10H,3,6,11-12H2,1-2H3,(H,21,22);1H.
What are the key properties of 3-[(4-methyl-1-nitroacridin-9-yl)amino]propyl propanoate;hydrochloride?
3-[(4-methyl-1-nitroacridin-9-yl)amino]propyl propanoate;hydrochloride has a molecular weight of 403.87 g/mol, XLogP of 4.78, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-methyl-1-nitroacridin-9-yl)amino]propyl propanoate;hydrochloride is sourced from PubChem (CID 18505074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).