About 2-methyl-1,3-oxazolidine-4-carboxamide
2-methyl-1,3-oxazolidine-4-carboxamide (PubChem CID 18505112) has the molecular formula C5H10N2O2
and a molecular weight of 130.15 g/mol. Its IUPAC name is 2-methyl-1,3-oxazolidine-4-carboxamide.
Molecular Properties
| Compound Name | 2-methyl-1,3-oxazolidine-4-carboxamide |
| PubChem CID | 18505112 |
| Molecular Formula | C5H10N2O2 |
| Molecular Weight | 130.15 g/mol |
| Exact Mass | 130.07 |
| IUPAC Name | 2-methyl-1,3-oxazolidine-4-carboxamide |
| SMILES | CC1NC(C(N)=O)CO1 |
| InChI | InChI=1S/C5H10N2O2/c1-3-7-4(2-9-3)5(6)8/h3-4,7H,2H2,1H3,(H2,6,8) |
| InChIKey | LKCIUTQSZNXLHI-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.15 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-1,3-oxazolidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1,3-oxazolidine-4-carboxamide?
The IUPAC name of 2-methyl-1,3-oxazolidine-4-carboxamide (CID 18505112) is 2-methyl-1,3-oxazolidine-4-carboxamide.
What is the SMILES notation for 2-methyl-1,3-oxazolidine-4-carboxamide?
The canonical SMILES for 2-methyl-1,3-oxazolidine-4-carboxamide is CC1NC(C(N)=O)CO1.
What is the InChIKey of 2-methyl-1,3-oxazolidine-4-carboxamide?
The InChIKey is LKCIUTQSZNXLHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O2/c1-3-7-4(2-9-3)5(6)8/h3-4,7H,2H2,1H3,(H2,6,8).
What are the key properties of 2-methyl-1,3-oxazolidine-4-carboxamide?
2-methyl-1,3-oxazolidine-4-carboxamide has a molecular weight of 130.15 g/mol, XLogP of -1.19, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1,3-oxazolidine-4-carboxamide is sourced from PubChem (CID 18505112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).