About 2-(oxiran-2-yl)propane-1,3-diol
2-(oxiran-2-yl)propane-1,3-diol (PubChem CID 18506434) has the molecular formula C5H10O3
and a molecular weight of 118.13 g/mol. Its IUPAC name is 2-(oxiran-2-yl)propane-1,3-diol.
Molecular Properties
| Compound Name | 2-(oxiran-2-yl)propane-1,3-diol |
| PubChem CID | 18506434 |
| Molecular Formula | C5H10O3 |
| Molecular Weight | 118.13 g/mol |
| Exact Mass | 118.06 |
| IUPAC Name | 2-(oxiran-2-yl)propane-1,3-diol |
| SMILES | OCC(CO)C1CO1 |
| InChI | InChI=1S/C5H10O3/c6-1-4(2-7)5-3-8-5/h4-7H,1-3H2 |
| InChIKey | LARRKHGUVLRDNW-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.13 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(oxiran-2-yl)propane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxiran-2-yl)propane-1,3-diol?
The IUPAC name of 2-(oxiran-2-yl)propane-1,3-diol (CID 18506434) is 2-(oxiran-2-yl)propane-1,3-diol.
What is the SMILES notation for 2-(oxiran-2-yl)propane-1,3-diol?
The canonical SMILES for 2-(oxiran-2-yl)propane-1,3-diol is OCC(CO)C1CO1.
What is the InChIKey of 2-(oxiran-2-yl)propane-1,3-diol?
The InChIKey is LARRKHGUVLRDNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O3/c6-1-4(2-7)5-3-8-5/h4-7H,1-3H2.
What are the key properties of 2-(oxiran-2-yl)propane-1,3-diol?
2-(oxiran-2-yl)propane-1,3-diol has a molecular weight of 118.13 g/mol, XLogP of -1.01, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxiran-2-yl)propane-1,3-diol is sourced from PubChem (CID 18506434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).