About 5,5-dichloropentyl formate
5,5-dichloropentyl formate (PubChem CID 18506663) has the molecular formula C6H10Cl2O2
and a molecular weight of 185.05 g/mol. Its IUPAC name is 5,5-dichloropentyl formate.
Molecular Properties
| Compound Name | 5,5-dichloropentyl formate |
| PubChem CID | 18506663 |
| Molecular Formula | C6H10Cl2O2 |
| Molecular Weight | 185.05 g/mol |
| Exact Mass | 184.01 |
| IUPAC Name | 5,5-dichloropentyl formate |
| SMILES | O=COCCCCC(Cl)Cl |
| InChI | InChI=1S/C6H10Cl2O2/c7-6(8)3-1-2-4-10-5-9/h5-6H,1-4H2 |
| InChIKey | PIEUMISOZQJRDV-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.05 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dichloropentyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dichloropentyl formate?
The IUPAC name of 5,5-dichloropentyl formate (CID 18506663) is 5,5-dichloropentyl formate.
What is the SMILES notation for 5,5-dichloropentyl formate?
The canonical SMILES for 5,5-dichloropentyl formate is O=COCCCCC(Cl)Cl.
What is the InChIKey of 5,5-dichloropentyl formate?
The InChIKey is PIEUMISOZQJRDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10Cl2O2/c7-6(8)3-1-2-4-10-5-9/h5-6H,1-4H2.
What are the key properties of 5,5-dichloropentyl formate?
5,5-dichloropentyl formate has a molecular weight of 185.05 g/mol, XLogP of 2.13, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dichloropentyl formate is sourced from PubChem (CID 18506663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).