About 3-chlorobenzenethiol;2-phenylbenzenethiol
3-chlorobenzenethiol;2-phenylbenzenethiol (PubChem CID 18506692) has the molecular formula C18H15ClS2
and a molecular weight of 330.91 g/mol. Its IUPAC name is 3-chlorobenzenethiol;2-phenylbenzenethiol.
Molecular Properties
| Compound Name | 3-chlorobenzenethiol;2-phenylbenzenethiol |
| PubChem CID | 18506692 |
| Molecular Formula | C18H15ClS2 |
| Molecular Weight | 330.91 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 3-chlorobenzenethiol;2-phenylbenzenethiol |
| SMILES | Sc1cccc(Cl)c1.Sc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C12H10S.C6H5ClS/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;7-5-2-1-3-6(8)4-5/h1-9,13H;1-4,8H |
| InChIKey | LIEIACWSPRACTR-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 330.91 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-chlorobenzenethiol;2-phenylbenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chlorobenzenethiol;2-phenylbenzenethiol?
The IUPAC name of 3-chlorobenzenethiol;2-phenylbenzenethiol (CID 18506692) is 3-chlorobenzenethiol;2-phenylbenzenethiol.
What is the SMILES notation for 3-chlorobenzenethiol;2-phenylbenzenethiol?
The canonical SMILES for 3-chlorobenzenethiol;2-phenylbenzenethiol is Sc1cccc(Cl)c1.Sc1ccccc1-c1ccccc1.
What is the InChIKey of 3-chlorobenzenethiol;2-phenylbenzenethiol?
The InChIKey is LIEIACWSPRACTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10S.C6H5ClS/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;7-5-2-1-3-6(8)4-5/h1-9,13H;1-4,8H.
What are the key properties of 3-chlorobenzenethiol;2-phenylbenzenethiol?
3-chlorobenzenethiol;2-phenylbenzenethiol has a molecular weight of 330.91 g/mol, XLogP of 6.27, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chlorobenzenethiol;2-phenylbenzenethiol is sourced from PubChem (CID 18506692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).