About [6-[(5-phenyl-1,3-thiazol-2-yl)amino]-2-pyridinyl]methanol
[6-[(5-phenyl-1,3-thiazol-2-yl)amino]-2-pyridinyl]methanol (PubChem CID 18506891) has the molecular formula C15H13N3OS
and a molecular weight of 283.36 g/mol. Its IUPAC name is [6-[(5-phenyl-1,3-thiazol-2-yl)amino]-2-pyridinyl]methanol.
Molecular Properties
| Compound Name | [6-[(5-phenyl-1,3-thiazol-2-yl)amino]-2-pyridinyl]methanol |
| PubChem CID | 18506891 |
| Molecular Formula | C15H13N3OS |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | [6-[(5-phenyl-1,3-thiazol-2-yl)amino]-2-pyridinyl]methanol |
| SMILES | OCc1cccc(Nc2ncc(-c3ccccc3)s2)n1 |
| InChI | InChI=1S/C15H13N3OS/c19-10-12-7-4-8-14(17-12)18-15-16-9-13(20-15)11-5-2-1-3-6-11/h1-9,19H,10H2,(H,16,17,18) |
| InChIKey | FVTPIEHQEQYHIL-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [6-[(5-phenyl-1,3-thiazol-2-yl)amino]-2-pyridinyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-[(5-phenyl-1,3-thiazol-2-yl)amino]-2-pyridinyl]methanol?
The IUPAC name of [6-[(5-phenyl-1,3-thiazol-2-yl)amino]-2-pyridinyl]methanol (CID 18506891) is [6-[(5-phenyl-1,3-thiazol-2-yl)amino]-2-pyridinyl]methanol.
What is the SMILES notation for [6-[(5-phenyl-1,3-thiazol-2-yl)amino]-2-pyridinyl]methanol?
The canonical SMILES for [6-[(5-phenyl-1,3-thiazol-2-yl)amino]-2-pyridinyl]methanol is OCc1cccc(Nc2ncc(-c3ccccc3)s2)n1.
What is the InChIKey of [6-[(5-phenyl-1,3-thiazol-2-yl)amino]-2-pyridinyl]methanol?
The InChIKey is FVTPIEHQEQYHIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N3OS/c19-10-12-7-4-8-14(17-12)18-15-16-9-13(20-15)11-5-2-1-3-6-11/h1-9,19H,10H2,(H,16,17,18).
What are the key properties of [6-[(5-phenyl-1,3-thiazol-2-yl)amino]-2-pyridinyl]methanol?
[6-[(5-phenyl-1,3-thiazol-2-yl)amino]-2-pyridinyl]methanol has a molecular weight of 283.36 g/mol, XLogP of 3.44, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [6-[(5-phenyl-1,3-thiazol-2-yl)amino]-2-pyridinyl]methanol is sourced from PubChem (CID 18506891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).