About 2-amino-4,6-diphenylpyrimidine-5-carbonitrile
2-amino-4,6-diphenylpyrimidine-5-carbonitrile (PubChem CID 18507264) has the molecular formula C17H12N4
and a molecular weight of 272.31 g/mol. Its IUPAC name is 2-amino-4,6-diphenylpyrimidine-5-carbonitrile.
Molecular Properties
| Compound Name | 2-amino-4,6-diphenylpyrimidine-5-carbonitrile |
| PubChem CID | 18507264 |
| Molecular Formula | C17H12N4 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 2-amino-4,6-diphenylpyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(-c2ccccc2)nc(N)nc1-c1ccccc1 |
| InChI | InChI=1S/C17H12N4/c18-11-14-15(12-7-3-1-4-8-12)20-17(19)21-16(14)13-9-5-2-6-10-13/h1-10H,(H2,19,20,21) |
| InChIKey | JMXZSEAMWCKILY-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-4,6-diphenylpyrimidine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4,6-diphenylpyrimidine-5-carbonitrile?
The IUPAC name of 2-amino-4,6-diphenylpyrimidine-5-carbonitrile (CID 18507264) is 2-amino-4,6-diphenylpyrimidine-5-carbonitrile.
What is the SMILES notation for 2-amino-4,6-diphenylpyrimidine-5-carbonitrile?
The canonical SMILES for 2-amino-4,6-diphenylpyrimidine-5-carbonitrile is N#Cc1c(-c2ccccc2)nc(N)nc1-c1ccccc1.
What is the InChIKey of 2-amino-4,6-diphenylpyrimidine-5-carbonitrile?
The InChIKey is JMXZSEAMWCKILY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12N4/c18-11-14-15(12-7-3-1-4-8-12)20-17(19)21-16(14)13-9-5-2-6-10-13/h1-10H,(H2,19,20,21).
What are the key properties of 2-amino-4,6-diphenylpyrimidine-5-carbonitrile?
2-amino-4,6-diphenylpyrimidine-5-carbonitrile has a molecular weight of 272.31 g/mol, XLogP of 3.26, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4,6-diphenylpyrimidine-5-carbonitrile is sourced from PubChem (CID 18507264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).