About 2-[2-(5,7-ditert-butyl-2-oxo-3H-1-benzofuran-3-yl)phenoxy]ethyl acetate
2-[2-(5,7-ditert-butyl-2-oxo-3H-1-benzofuran-3-yl)phenoxy]ethyl acetate (PubChem CID 18508411) has the molecular formula C26H32O5
and a molecular weight of 424.54 g/mol. Its IUPAC name is 2-[2-(5,7-ditert-butyl-2-oxo-3H-1-benzofuran-3-yl)phenoxy]ethyl acetate.
Molecular Properties
| Compound Name | 2-[2-(5,7-ditert-butyl-2-oxo-3H-1-benzofuran-3-yl)phenoxy]ethyl acetate |
| PubChem CID | 18508411 |
| Molecular Formula | C26H32O5 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 2-[2-(5,7-ditert-butyl-2-oxo-3H-1-benzofuran-3-yl)phenoxy]ethyl acetate |
| SMILES | CC(=O)OCCOc1ccccc1C1C(=O)Oc2c1cc(C(C)(C)C)cc2C(C)(C)C |
| InChI | InChI=1S/C26H32O5/c1-16(27)29-12-13-30-21-11-9-8-10-18(21)22-19-14-17(25(2,3)4)15-20(26(5,6)7)23(19)31-24(22)28/h8-11,14-15,22H,12-13H2,1-7H3 |
| InChIKey | CVMSUQFGJMIOMH-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(5,7-ditert-butyl-2-oxo-3H-1-benzofuran-3-yl)phenoxy]ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(5,7-ditert-butyl-2-oxo-3H-1-benzofuran-3-yl)phenoxy]ethyl acetate?
The IUPAC name of 2-[2-(5,7-ditert-butyl-2-oxo-3H-1-benzofuran-3-yl)phenoxy]ethyl acetate (CID 18508411) is 2-[2-(5,7-ditert-butyl-2-oxo-3H-1-benzofuran-3-yl)phenoxy]ethyl acetate.
What is the SMILES notation for 2-[2-(5,7-ditert-butyl-2-oxo-3H-1-benzofuran-3-yl)phenoxy]ethyl acetate?
The canonical SMILES for 2-[2-(5,7-ditert-butyl-2-oxo-3H-1-benzofuran-3-yl)phenoxy]ethyl acetate is CC(=O)OCCOc1ccccc1C1C(=O)Oc2c1cc(C(C)(C)C)cc2C(C)(C)C.
What is the InChIKey of 2-[2-(5,7-ditert-butyl-2-oxo-3H-1-benzofuran-3-yl)phenoxy]ethyl acetate?
The InChIKey is CVMSUQFGJMIOMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H32O5/c1-16(27)29-12-13-30-21-11-9-8-10-18(21)22-19-14-17(25(2,3)4)15-20(26(5,6)7)23(19)31-24(22)28/h8-11,14-15,22H,12-13H2,1-7H3.
What are the key properties of 2-[2-(5,7-ditert-butyl-2-oxo-3H-1-benzofuran-3-yl)phenoxy]ethyl acetate?
2-[2-(5,7-ditert-butyl-2-oxo-3H-1-benzofuran-3-yl)phenoxy]ethyl acetate has a molecular weight of 424.54 g/mol, XLogP of 5.27, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(5,7-ditert-butyl-2-oxo-3H-1-benzofuran-3-yl)phenoxy]ethyl acetate is sourced from PubChem (CID 18508411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).