About 1,4-diisocyanatocyclohexane;1-isocyanato-4-[(4-isocyanatocyclohexyl)methyl]cyclohexane
1,4-diisocyanatocyclohexane;1-isocyanato-4-[(4-isocyanatocyclohexyl)methyl]cyclohexane (PubChem CID 18508442) has the molecular formula C23H32N4O4
and a molecular weight of 428.53 g/mol. Its IUPAC name is 1,4-diisocyanatocyclohexane;1-isocyanato-4-[(4-isocyanatocyclohexyl)methyl]cyclohexane.
Molecular Properties
| Compound Name | 1,4-diisocyanatocyclohexane;1-isocyanato-4-[(4-isocyanatocyclohexyl)methyl]cyclohexane |
| PubChem CID | 18508442 |
| Molecular Formula | C23H32N4O4 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | 1,4-diisocyanatocyclohexane;1-isocyanato-4-[(4-isocyanatocyclohexyl)methyl]cyclohexane |
| SMILES | O=C=NC1CCC(CC2CCC(N=C=O)CC2)CC1.O=C=NC1CCC(N=C=O)CC1 |
| InChI | InChI=1S/C15H22N2O2.C8H10N2O2/c18-10-16-14-5-1-12(2-6-14)9-13-3-7-15(8-4-13)17-11-19;11-5-9-7-1-2-8(4-3-7)10-6-12/h12-15H,1-9H2;7-8H,1-4H2 |
| InChIKey | KBTFWLZJSLXIQP-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 117.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 1,4-diisocyanatocyclohexane;1-isocyanato-4-[(4-isocyanatocyclohexyl)methyl]cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-diisocyanatocyclohexane;1-isocyanato-4-[(4-isocyanatocyclohexyl)methyl]cyclohexane?
The IUPAC name of 1,4-diisocyanatocyclohexane;1-isocyanato-4-[(4-isocyanatocyclohexyl)methyl]cyclohexane (CID 18508442) is 1,4-diisocyanatocyclohexane;1-isocyanato-4-[(4-isocyanatocyclohexyl)methyl]cyclohexane.
What is the SMILES notation for 1,4-diisocyanatocyclohexane;1-isocyanato-4-[(4-isocyanatocyclohexyl)methyl]cyclohexane?
The canonical SMILES for 1,4-diisocyanatocyclohexane;1-isocyanato-4-[(4-isocyanatocyclohexyl)methyl]cyclohexane is O=C=NC1CCC(CC2CCC(N=C=O)CC2)CC1.O=C=NC1CCC(N=C=O)CC1.
What is the InChIKey of 1,4-diisocyanatocyclohexane;1-isocyanato-4-[(4-isocyanatocyclohexyl)methyl]cyclohexane?
The InChIKey is KBTFWLZJSLXIQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O2.C8H10N2O2/c18-10-16-14-5-1-12(2-6-14)9-13-3-7-15(8-4-13)17-11-19;11-5-9-7-1-2-8(4-3-7)10-6-12/h12-15H,1-9H2;7-8H,1-4H2.
What are the key properties of 1,4-diisocyanatocyclohexane;1-isocyanato-4-[(4-isocyanatocyclohexyl)methyl]cyclohexane?
1,4-diisocyanatocyclohexane;1-isocyanato-4-[(4-isocyanatocyclohexyl)methyl]cyclohexane has a molecular weight of 428.53 g/mol, XLogP of 4.13, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-diisocyanatocyclohexane;1-isocyanato-4-[(4-isocyanatocyclohexyl)methyl]cyclohexane is sourced from PubChem (CID 18508442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).