C13H8O4 — CID 18509947
2,5-dihydroxanthene-3,6,9-trione (PubChem CID 18509947) has the molecular formula C13H8O4 and a molecular weight of 228.20 g/mol. Its IUPAC name is 2,5-dihydroxanthene-3,6,9-trione.
| Compound Name | 2,5-dihydroxanthene-3,6,9-trione |
|---|---|
| PubChem CID | 18509947 |
| Molecular Formula | C13H8O4 |
| Molecular Weight | 228.20 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 2,5-dihydroxanthene-3,6,9-trione |
| SMILES | O=C1C=c2oc3c(c(=O)c2=CC1)C=CC(=O)C3 |
| InChI | InChI=1S/C13H8O4/c14-7-1-3-9-11(5-7)17-12-6-8(15)2-4-10(12)13(9)16/h1,3-4,6H,2,5H2 |
| InChIKey | ZFYPIIIBSZLKSA-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 64.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.20 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |