C26H31N3O2S — CID 18510510
N-benzyl-3-(6,7-dimethyl-10-oxo-2-propoxypyrido[2,3-b][1,4]benzothiazin-5-yl)propan-1-amine (PubChem CID 18510510) has the molecular formula C26H31N3O2S and a molecular weight of 449.62 g/mol. Its IUPAC name is N-benzyl-3-(6,7-dimethyl-10-oxo-2-propoxypyrido[2,3-b][1,4]benzothiazin-5-yl)propan-1-amine.
| Compound Name | N-benzyl-3-(6,7-dimethyl-10-oxo-2-propoxypyrido[2,3-b][1,4]benzothiazin-5-yl)propan-1-amine |
|---|---|
| PubChem CID | 18510510 |
| Molecular Formula | C26H31N3O2S |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | N-benzyl-3-(6,7-dimethyl-10-oxo-2-propoxypyrido[2,3-b][1,4]benzothiazin-5-yl)propan-1-amine |
| SMILES | CCCOc1ccc2c(n1)S(=O)c1ccc(C)c(C)c1N2CCCNCc1ccccc1 |
| InChI | InChI=1S/C26H31N3O2S/c1-4-17-31-24-14-12-22-26(28-24)32(30)23-13-11-19(2)20(3)25(23)29(22)16-8-15-27-18-21-9-6-5-7-10-21/h5-7,9-14,27H,4,8,15-18H2,1-3H3 |
| InChIKey | DUHMIYYNKPRLFO-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|