C23H28N4O2 — CID 18511152
[4-[2-(1-methylpiperidin-4-yl)-5H-pyrrolo[3,2-d]pyrimidin-6-yl]phenyl] 2,2-dimethylpropanoate (PubChem CID 18511152) has the molecular formula C23H28N4O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is [4-[2-(1-methylpiperidin-4-yl)-5H-pyrrolo[3,2-d]pyrimidin-6-yl]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [4-[2-(1-methylpiperidin-4-yl)-5H-pyrrolo[3,2-d]pyrimidin-6-yl]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 18511152 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | [4-[2-(1-methylpiperidin-4-yl)-5H-pyrrolo[3,2-d]pyrimidin-6-yl]phenyl] 2,2-dimethylpropanoate |
| SMILES | CN1CCC(c2ncc3[nH]c(-c4ccc(OC(=O)C(C)(C)C)cc4)cc3n2)CC1 |
| InChI | InChI=1S/C23H28N4O2/c1-23(2,3)22(28)29-17-7-5-15(6-8-17)18-13-19-20(25-18)14-24-21(26-19)16-9-11-27(4)12-10-16/h5-8,13-14,16,25H,9-12H2,1-4H3 |
| InChIKey | IWGNQQANZJKHFT-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|