About 6-(1-benzofuran-2-yl)-2-piperidin-4-yl-5H-pyrrolo[3,2-d]pyrimidine;hydrate;hydrochloride
6-(1-benzofuran-2-yl)-2-piperidin-4-yl-5H-pyrrolo[3,2-d]pyrimidine;hydrate;hydrochloride (PubChem CID 18511193) has the molecular formula C19H21ClN4O2
and a molecular weight of 372.86 g/mol. Its IUPAC name is 6-(1-benzofuran-2-yl)-2-piperidin-4-yl-5H-pyrrolo[3,2-d]pyrimidine;hydrate;hydrochloride.
Molecular Properties
| Compound Name | 6-(1-benzofuran-2-yl)-2-piperidin-4-yl-5H-pyrrolo[3,2-d]pyrimidine;hydrate;hydrochloride |
| PubChem CID | 18511193 |
| Molecular Formula | C19H21ClN4O2 |
| Molecular Weight | 372.86 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 6-(1-benzofuran-2-yl)-2-piperidin-4-yl-5H-pyrrolo[3,2-d]pyrimidine;hydrate;hydrochloride |
| SMILES | Cl.O.c1ccc2oc(-c3cc4nc(C5CCNCC5)ncc4[nH]3)cc2c1 |
| InChI | InChI=1S/C19H18N4O.ClH.H2O/c1-2-4-17-13(3-1)9-18(24-17)15-10-14-16(22-15)11-21-19(23-14)12-5-7-20-8-6-12;;/h1-4,9-12,20,22H,5-8H2;1H;1H2 |
| InChIKey | YXJRFCSPYWNCME-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 98.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.86 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(1-benzofuran-2-yl)-2-piperidin-4-yl-5H-pyrrolo[3,2-d]pyrimidine;hydrate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1-benzofuran-2-yl)-2-piperidin-4-yl-5H-pyrrolo[3,2-d]pyrimidine;hydrate;hydrochloride?
The IUPAC name of 6-(1-benzofuran-2-yl)-2-piperidin-4-yl-5H-pyrrolo[3,2-d]pyrimidine;hydrate;hydrochloride (CID 18511193) is 6-(1-benzofuran-2-yl)-2-piperidin-4-yl-5H-pyrrolo[3,2-d]pyrimidine;hydrate;hydrochloride.
What is the SMILES notation for 6-(1-benzofuran-2-yl)-2-piperidin-4-yl-5H-pyrrolo[3,2-d]pyrimidine;hydrate;hydrochloride?
The canonical SMILES for 6-(1-benzofuran-2-yl)-2-piperidin-4-yl-5H-pyrrolo[3,2-d]pyrimidine;hydrate;hydrochloride is Cl.O.c1ccc2oc(-c3cc4nc(C5CCNCC5)ncc4[nH]3)cc2c1.
What is the InChIKey of 6-(1-benzofuran-2-yl)-2-piperidin-4-yl-5H-pyrrolo[3,2-d]pyrimidine;hydrate;hydrochloride?
The InChIKey is YXJRFCSPYWNCME-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N4O.ClH.H2O/c1-2-4-17-13(3-1)9-18(24-17)15-10-14-16(22-15)11-21-19(23-14)12-5-7-20-8-6-12;;/h1-4,9-12,20,22H,5-8H2;1H;1H2.
What are the key properties of 6-(1-benzofuran-2-yl)-2-piperidin-4-yl-5H-pyrrolo[3,2-d]pyrimidine;hydrate;hydrochloride?
6-(1-benzofuran-2-yl)-2-piperidin-4-yl-5H-pyrrolo[3,2-d]pyrimidine;hydrate;hydrochloride has a molecular weight of 372.86 g/mol, XLogP of 3.44, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1-benzofuran-2-yl)-2-piperidin-4-yl-5H-pyrrolo[3,2-d]pyrimidine;hydrate;hydrochloride is sourced from PubChem (CID 18511193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).