About 4-(1-benzofuran-2-yl)-2,8-bis(trifluoromethyl)quinoline
4-(1-benzofuran-2-yl)-2,8-bis(trifluoromethyl)quinoline (PubChem CID 18511419) has the molecular formula C19H9F6NO
and a molecular weight of 381.28 g/mol. Its IUPAC name is 4-(1-benzofuran-2-yl)-2,8-bis(trifluoromethyl)quinoline.
Molecular Properties
| Compound Name | 4-(1-benzofuran-2-yl)-2,8-bis(trifluoromethyl)quinoline |
| PubChem CID | 18511419 |
| Molecular Formula | C19H9F6NO |
| Molecular Weight | 381.28 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | 4-(1-benzofuran-2-yl)-2,8-bis(trifluoromethyl)quinoline |
| SMILES | FC(F)(F)c1cc(-c2cc3ccccc3o2)c2cccc(C(F)(F)F)c2n1 |
| InChI | InChI=1S/C19H9F6NO/c20-18(21,22)13-6-3-5-11-12(9-16(19(23,24)25)26-17(11)13)15-8-10-4-1-2-7-14(10)27-15/h1-9H |
| InChIKey | DVDSPWNLQDIHFR-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.28 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(1-benzofuran-2-yl)-2,8-bis(trifluoromethyl)quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-benzofuran-2-yl)-2,8-bis(trifluoromethyl)quinoline?
The IUPAC name of 4-(1-benzofuran-2-yl)-2,8-bis(trifluoromethyl)quinoline (CID 18511419) is 4-(1-benzofuran-2-yl)-2,8-bis(trifluoromethyl)quinoline.
What is the SMILES notation for 4-(1-benzofuran-2-yl)-2,8-bis(trifluoromethyl)quinoline?
The canonical SMILES for 4-(1-benzofuran-2-yl)-2,8-bis(trifluoromethyl)quinoline is FC(F)(F)c1cc(-c2cc3ccccc3o2)c2cccc(C(F)(F)F)c2n1.
What is the InChIKey of 4-(1-benzofuran-2-yl)-2,8-bis(trifluoromethyl)quinoline?
The InChIKey is DVDSPWNLQDIHFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H9F6NO/c20-18(21,22)13-6-3-5-11-12(9-16(19(23,24)25)26-17(11)13)15-8-10-4-1-2-7-14(10)27-15/h1-9H.
What are the key properties of 4-(1-benzofuran-2-yl)-2,8-bis(trifluoromethyl)quinoline?
4-(1-benzofuran-2-yl)-2,8-bis(trifluoromethyl)quinoline has a molecular weight of 381.28 g/mol, XLogP of 6.69, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-benzofuran-2-yl)-2,8-bis(trifluoromethyl)quinoline is sourced from PubChem (CID 18511419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).