C23H27F4N3OS — CID 18511639
1-[1-[4-(3,4-difluorophenoxy)butyl]piperidin-4-yl]-3-(2,6-difluorophenyl)-1-methylthiourea (PubChem CID 18511639) has the molecular formula C23H27F4N3OS and a molecular weight of 469.55 g/mol. Its IUPAC name is 1-[1-[4-(3,4-difluorophenoxy)butyl]piperidin-4-yl]-3-(2,6-difluorophenyl)-1-methylthiourea.
| Compound Name | 1-[1-[4-(3,4-difluorophenoxy)butyl]piperidin-4-yl]-3-(2,6-difluorophenyl)-1-methylthiourea |
|---|---|
| PubChem CID | 18511639 |
| Molecular Formula | C23H27F4N3OS |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | 1-[1-[4-(3,4-difluorophenoxy)butyl]piperidin-4-yl]-3-(2,6-difluorophenyl)-1-methylthiourea |
| SMILES | CN(C(=S)Nc1c(F)cccc1F)C1CCN(CCCCOc2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C23H27F4N3OS/c1-29(23(32)28-22-19(25)5-4-6-20(22)26)16-9-12-30(13-10-16)11-2-3-14-31-17-7-8-18(24)21(27)15-17/h4-8,15-16H,2-3,9-14H2,1H3,(H,28,32) |
| InChIKey | WDZMTSHZEFJDKG-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|